About bis(tri(butan-2-yloxy)-hydroxysilane);zirconium
bis(tri(butan-2-yloxy)-hydroxysilane);zirconium (PubChem CID 175131164) has the molecular formula C24H56O8Si2Zr
and a molecular weight of 620.10 g/mol. Its IUPAC name is bis(tri(butan-2-yloxy)-hydroxysilane);zirconium.
Molecular Properties
| Compound Name | bis(tri(butan-2-yloxy)-hydroxysilane);zirconium |
| PubChem CID | 175131164 |
| Molecular Formula | C24H56O8Si2Zr |
| Molecular Weight | 620.10 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | bis(tri(butan-2-yloxy)-hydroxysilane);zirconium |
| SMILES | CCC(C)O[Si](O)(OC(C)CC)OC(C)CC.CCC(C)O[Si](O)(OC(C)CC)OC(C)CC.[Zr] |
| InChI | InChI=1S/2C12H28O4Si.Zr/c2*1-7-10(4)14-17(13,15-11(5)8-2)16-12(6)9-3;/h2*10-13H,7-9H2,1-6H3; |
| InChIKey | DYQZNFUXBVSTGV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 620.10 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(tri(butan-2-yloxy)-hydroxysilane);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tri(butan-2-yloxy)-hydroxysilane);zirconium?
The IUPAC name of bis(tri(butan-2-yloxy)-hydroxysilane);zirconium (CID 175131164) is bis(tri(butan-2-yloxy)-hydroxysilane);zirconium.
What is the SMILES notation for bis(tri(butan-2-yloxy)-hydroxysilane);zirconium?
The canonical SMILES for bis(tri(butan-2-yloxy)-hydroxysilane);zirconium is CCC(C)O[Si](O)(OC(C)CC)OC(C)CC.CCC(C)O[Si](O)(OC(C)CC)OC(C)CC.[Zr].
What is the InChIKey of bis(tri(butan-2-yloxy)-hydroxysilane);zirconium?
The InChIKey is DYQZNFUXBVSTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H28O4Si.Zr/c2*1-7-10(4)14-17(13,15-11(5)8-2)16-12(6)9-3;/h2*10-13H,7-9H2,1-6H3;.
What are the key properties of bis(tri(butan-2-yloxy)-hydroxysilane);zirconium?
bis(tri(butan-2-yloxy)-hydroxysilane);zirconium has a molecular weight of 620.10 g/mol, XLogP of 5.72, 18 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tri(butan-2-yloxy)-hydroxysilane);zirconium is sourced from PubChem (CID 175131164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).