About silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate
silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate (PubChem CID 173439858) has the molecular formula C25H59ClO8Si3
and a molecular weight of 607.45 g/mol. Its IUPAC name is silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate.
Molecular Properties
| Compound Name | silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate |
| PubChem CID | 173439858 |
| Molecular Formula | C25H59ClO8Si3 |
| Molecular Weight | 607.45 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate |
| SMILES | CCC(C)O[Si](OC(C)CC)(OC(C)CC)OC(Cl)O[Si](OC(C)CC)(OC(C)CC)OC(C)CC.[SiH4] |
| InChI | InChI=1S/C25H55ClO8Si2.H4Si/c1-13-19(7)27-35(28-20(8)14-2,29-21(9)15-3)33-25(26)34-36(30-22(10)16-4,31-23(11)17-5)32-24(12)18-6;/h19-25H,13-18H2,1-12H3;1H4 |
| InChIKey | SXRNTIIMZBQMLM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate?
The IUPAC name of silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate (CID 173439858) is silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate.
What is the SMILES notation for silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate?
The canonical SMILES for silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate is CCC(C)O[Si](OC(C)CC)(OC(C)CC)OC(Cl)O[Si](OC(C)CC)(OC(C)CC)OC(C)CC.[SiH4].
What is the InChIKey of silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate?
The InChIKey is SXRNTIIMZBQMLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H55ClO8Si2.H4Si/c1-13-19(7)27-35(28-20(8)14-2,29-21(9)15-3)33-25(26)34-36(30-22(10)16-4,31-23(11)17-5)32-24(12)18-6;/h19-25H,13-18H2,1-12H3;1H4.
What are the key properties of silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate?
silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate has a molecular weight of 607.45 g/mol, XLogP of 5.85, 22 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for silane;tributan-2-yl [chloro-tri(butan-2-yloxy)silyloxymethyl] silicate is sourced from PubChem (CID 173439858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).