C28H62O13Si6 — CID 154103827
3-[dimethyl-tris[[3-acetyloxypropyl(dimethyl)silyl]oxy]silyloxysilyloxysilyl]propyl acetate (PubChem CID 154103827) has the molecular formula C28H62O13Si6 and a molecular weight of 775.31 g/mol. Its IUPAC name is 3-[dimethyl-tris[[3-acetyloxypropyl(dimethyl)silyl]oxy]silyloxysilyloxysilyl]propyl acetate.
| Compound Name | 3-[dimethyl-tris[[3-acetyloxypropyl(dimethyl)silyl]oxy]silyloxysilyloxysilyl]propyl acetate |
|---|---|
| PubChem CID | 154103827 |
| Molecular Formula | C28H62O13Si6 |
| Molecular Weight | 775.31 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | 3-[dimethyl-tris[[3-acetyloxypropyl(dimethyl)silyl]oxy]silyloxysilyloxysilyl]propyl acetate |
| SMILES | CC(=O)OCCC[Si](C)(C)O[SiH2]O[Si](O[Si](C)(C)CCCOC(C)=O)(O[Si](C)(C)CCCOC(C)=O)O[Si](C)(C)CCCOC(C)=O |
| InChI | InChI=1S/C28H62O13Si6/c1-25(29)33-17-13-21-43(5,6)37-42-38-47(39-44(7,8)22-14-18-34-26(2)30,40-45(9,10)23-15-19-35-27(3)31)41-46(11,12)24-16-20-36-28(4)32/h13-24,42H2,1-12H3 |
| InChIKey | CBFLYJHGPLUOHA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|