C11H20N2O2 — CID 91443581
(E)-2-amino-4-(2-methylbutylideneamino)hex-3-enoic acid (PubChem CID 91443581) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (E)-2-amino-4-(2-methylbutylideneamino)hex-3-enoic acid.
| Compound Name | (E)-2-amino-4-(2-methylbutylideneamino)hex-3-enoic acid |
|---|---|
| PubChem CID | 91443581 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (E)-2-amino-4-(2-methylbutylideneamino)hex-3-enoic acid |
| SMILES | CCC(=C\C(N)C(=O)O)/N=C/C(C)CC |
| InChI | InChI=1S/C11H20N2O2/c1-4-8(3)7-13-9(5-2)6-10(12)11(14)15/h6-8,10H,4-5,12H2,1-3H3,(H,14,15)/b9-6+,13-7+ |
| InChIKey | NOFCJBBMFOAVFP-KTKDNUBYSA-N |
| XLogP | 1.81 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|