C25H21Cl2N3O4 — CID 91444771
N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]quinoline-6-carboxamide (PubChem CID 91444771) has the molecular formula C25H21Cl2N3O4 and a molecular weight of 498.37 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]quinoline-6-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 91444771 |
| Molecular Formula | C25H21Cl2N3O4 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]quinoline-6-carboxamide |
| SMILES | O=C(NC(Cc1ccc(Cl)c(Cl)c1)C(=O)N1CCC2OCC(=O)C21)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C25H21Cl2N3O4/c26-17-5-3-14(10-18(17)27)11-20(25(33)30-9-7-22-23(30)21(31)13-34-22)29-24(32)16-4-6-19-15(12-16)2-1-8-28-19/h1-6,8,10,12,20,22-23H,7,9,11,13H2,(H,29,32) |
| InChIKey | VTRPLMDSBODQLJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |