C26H22Cl2N2O4S — CID 90958791
N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]-5-phenylthiophene-2-carboxamide (PubChem CID 90958791) has the molecular formula C26H22Cl2N2O4S and a molecular weight of 529.45 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]-5-phenylthiophene-2-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 90958791 |
| Molecular Formula | C26H22Cl2N2O4S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-(3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)propan-2-yl]-5-phenylthiophene-2-carboxamide |
| SMILES | O=C(NC(Cc1ccc(Cl)c(Cl)c1)C(=O)N1CCC2OCC(=O)C21)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C26H22Cl2N2O4S/c27-17-7-6-15(12-18(17)28)13-19(26(33)30-11-10-21-24(30)20(31)14-34-21)29-25(32)23-9-8-22(35-23)16-4-2-1-3-5-16/h1-9,12,19,21,24H,10-11,13-14H2,(H,29,32) |
| InChIKey | NDYMOKDPMIOIIF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |