C23H28N2O5S2 — CID 158366265
N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-2-phenylacetamide;sulfane (PubChem CID 158366265) has the molecular formula C23H28N2O5S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-2-phenylacetamide;sulfane.
| Compound Name | N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-2-phenylacetamide;sulfane |
|---|---|
| PubChem CID | 158366265 |
| Molecular Formula | C23H28N2O5S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-2-phenylacetamide;sulfane |
| SMILES | O=C(Cc1ccccc1)N[C@@H](Cc1ccc(O)cc1)C(=O)N1CC[C@H]2OCC(=O)[C@H]21.S.S |
| InChI | InChI=1S/C23H24N2O5.2H2S/c26-17-8-6-16(7-9-17)12-18(24-21(28)13-15-4-2-1-3-5-15)23(29)25-11-10-20-22(25)19(27)14-30-20;;/h1-9,18,20,22,26H,10-14H2,(H,24,28);2*1H2/t18-,20+,22+;;/m0../s1 |
| InChIKey | GUBJFWSIBTVLKY-VFMOBHMVSA-N |
| XLogP | 1.46 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |