C28H28N2O6 — CID 91331719
N-[3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-2-methyl-5-phenylfuran-3-carboxamide (PubChem CID 91331719) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is N-[3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-2-methyl-5-phenylfuran-3-carboxamide.
| Compound Name | N-[3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-2-methyl-5-phenylfuran-3-carboxamide |
|---|---|
| PubChem CID | 91331719 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-[3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-2-methyl-5-phenylfuran-3-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)cc1C(=O)NC(Cc1ccc(O)cc1)C(=O)N1CCCC2OCC(=O)C21 |
| InChI | InChI=1S/C28H28N2O6/c1-17-21(15-25(36-17)19-6-3-2-4-7-19)27(33)29-22(14-18-9-11-20(31)12-10-18)28(34)30-13-5-8-24-26(30)23(32)16-35-24/h2-4,6-7,9-12,15,22,24,26,31H,5,8,13-14,16H2,1H3,(H,29,33) |
| InChIKey | NMLSJJPNHXWMGY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |