C26H25N3O5S — CID 69051670
N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-5-thiophen-2-ylpyridine-3-carboxamide (PubChem CID 69051670) has the molecular formula C26H25N3O5S and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-5-thiophen-2-ylpyridine-3-carboxamide.
| Compound Name | N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-5-thiophen-2-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 69051670 |
| Molecular Formula | C26H25N3O5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-5-thiophen-2-ylpyridine-3-carboxamide |
| SMILES | O=C(N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCCC2OCC(=O)C21)c1cncc(-c2cccs2)c1 |
| InChI | InChI=1S/C26H25N3O5S/c30-19-7-5-16(6-8-19)11-20(26(33)29-9-1-3-22-24(29)21(31)15-34-22)28-25(32)18-12-17(13-27-14-18)23-4-2-10-35-23/h2,4-8,10,12-14,20,22,24,30H,1,3,9,11,15H2,(H,28,32)/t20-,22?,24?/m0/s1 |
| InChIKey | BQZKTZDYLMPEKT-INVBSJAUSA-N |
| XLogP | 2.82 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |