C27H26N2O5S — CID 69049075
N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-4-thiophen-2-ylbenzamide (PubChem CID 69049075) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 69049075 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[(2S)-3-(4-hydroxyphenyl)-1-oxo-1-(3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl)propan-2-yl]-4-thiophen-2-ylbenzamide |
| SMILES | O=C(N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCCC2OCC(=O)C21)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c30-20-11-5-17(6-12-20)15-21(27(33)29-13-1-3-23-25(29)22(31)16-34-23)28-26(32)19-9-7-18(8-10-19)24-4-2-14-35-24/h2,4-12,14,21,23,25,30H,1,3,13,15-16H2,(H,28,32)/t21-,23?,25?/m0/s1 |
| InChIKey | GYDQXLMHCFTVAH-QDBMRNDTSA-N |
| XLogP | 3.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |