C24H26N2O4 — CID 59791716
N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide (PubChem CID 59791716) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide.
| Compound Name | N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 59791716 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[(2S)-1-[(3aS,6aR)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-oxo-3-phenylpropan-2-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N[C@@H](Cc1ccccc1)C(=O)N1CC[C@H]2OCC(=O)[C@H]21 |
| InChI | InChI=1S/C24H26N2O4/c27-20-16-30-21-13-14-26(23(20)21)24(29)19(15-18-9-5-2-6-10-18)25-22(28)12-11-17-7-3-1-4-8-17/h1-10,19,21,23H,11-16H2,(H,25,28)/t19-,21+,23+/m0/s1 |
| InChIKey | OWDRLLJBWPJNJX-XKCSPQBFSA-N |
| XLogP | 1.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |