About (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride
(2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride (PubChem CID 91445255) has the molecular formula C9H15Cl2NO3S
and a molecular weight of 288.20 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride.
Molecular Properties
| Compound Name | (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride |
| PubChem CID | 91445255 |
| Molecular Formula | C9H15Cl2NO3S |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride |
| SMILES | CC.CS(=O)(=O)Cl.OCc1cccnc1Cl |
| InChI | InChI=1S/C6H6ClNO.C2H6.CH3ClO2S/c7-6-5(4-9)2-1-3-8-6;1-2;1-5(2,3)4/h1-3,9H,4H2;1-2H3;1H3 |
| InChIKey | PYUDIKWMAVUIIJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride?
The IUPAC name of (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride (CID 91445255) is (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride.
What is the SMILES notation for (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride?
The canonical SMILES for (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride is CC.CS(=O)(=O)Cl.OCc1cccnc1Cl.
What is the InChIKey of (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride?
The InChIKey is PYUDIKWMAVUIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO.C2H6.CH3ClO2S/c7-6-5(4-9)2-1-3-8-6;1-2;1-5(2,3)4/h1-3,9H,4H2;1-2H3;1H3.
What are the key properties of (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride?
(2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride has a molecular weight of 288.20 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3-pyridinyl)methanol;ethane;methanesulfonyl chloride is sourced from PubChem (CID 91445255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).