C23H21N3O4 — CID 91445620
(2S)-2-[(2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid (PubChem CID 91445620) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (2S)-2-[(2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[(2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 91445620 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2S)-2-[(2,2-dimethyl-3-oxocyclobutylidene)amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid |
| SMILES | CC1(C)C(=O)C/C1=N\[C@@H](Cc1ccc(Oc2nccc3ccncc23)cc1)C(=O)O |
| InChI | InChI=1S/C23H21N3O4/c1-23(2)19(12-20(23)27)26-18(22(28)29)11-14-3-5-16(6-4-14)30-21-17-13-24-9-7-15(17)8-10-25-21/h3-10,13,18H,11-12H2,1-2H3,(H,28,29)/b26-19+/t18-/m0/s1 |
| InChIKey | VNGAHAMRLBHHNF-XIQGZHOOSA-N |
| XLogP | 3.86 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|