C15H9Cl4N3O2 — CID 91446441
3,4-dichloro-N-[[1-(3,4-dichlorophenyl)-2-nitrosoethylidene]amino]benzamide (PubChem CID 91446441) has the molecular formula C15H9Cl4N3O2 and a molecular weight of 405.07 g/mol. Its IUPAC name is 3,4-dichloro-N-[[1-(3,4-dichlorophenyl)-2-nitrosoethylidene]amino]benzamide.
| Compound Name | 3,4-dichloro-N-[[1-(3,4-dichlorophenyl)-2-nitrosoethylidene]amino]benzamide |
|---|---|
| PubChem CID | 91446441 |
| Molecular Formula | C15H9Cl4N3O2 |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 3,4-dichloro-N-[[1-(3,4-dichlorophenyl)-2-nitrosoethylidene]amino]benzamide |
| SMILES | O=NCC(=NNC(=O)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl4N3O2/c16-10-3-1-8(5-12(10)18)14(7-20-24)21-22-15(23)9-2-4-11(17)13(19)6-9/h1-6H,7H2,(H,22,23) |
| InChIKey | QNRPGGMUPHUPJJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|