C9H14N2O — CID 91447042
3-methyl-4,4a,5,6,7,8-hexahydroquinazolin-2-one (PubChem CID 91447042) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-methyl-4,4a,5,6,7,8-hexahydroquinazolin-2-one.
| Compound Name | 3-methyl-4,4a,5,6,7,8-hexahydroquinazolin-2-one |
|---|---|
| PubChem CID | 91447042 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-methyl-4,4a,5,6,7,8-hexahydroquinazolin-2-one |
| SMILES | CN1CC2CCCCC2=NC1=O |
| InChI | InChI=1S/C9H14N2O/c1-11-6-7-4-2-3-5-8(7)10-9(11)12/h7H,2-6H2,1H3 |
| InChIKey | TZRVLXKMVZBGDU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |