C21H38O5 — CID 91447054
3,4-dihydroxy-3-(1-hydroxy-4-methylpentyl)-5-(3-methylbutanoyl)-2-(3-methylbutyl)cyclopentan-1-one (PubChem CID 91447054) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is 3,4-dihydroxy-3-(1-hydroxy-4-methylpentyl)-5-(3-methylbutanoyl)-2-(3-methylbutyl)cyclopentan-1-one.
| Compound Name | 3,4-dihydroxy-3-(1-hydroxy-4-methylpentyl)-5-(3-methylbutanoyl)-2-(3-methylbutyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 91447054 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 3,4-dihydroxy-3-(1-hydroxy-4-methylpentyl)-5-(3-methylbutanoyl)-2-(3-methylbutyl)cyclopentan-1-one |
| SMILES | CC(C)CCC(O)C1(O)C(CCC(C)C)C(=O)C(C(=O)CC(C)C)C1O |
| InChI | InChI=1S/C21H38O5/c1-12(2)7-9-15-19(24)18(16(22)11-14(5)6)20(25)21(15,26)17(23)10-8-13(3)4/h12-15,17-18,20,23,25-26H,7-11H2,1-6H3 |
| InChIKey | GOBCJKJUMATDFL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|