C29H33N3O7 — CID 91447981
(3R,5S,8S)-8-(5-methyl-3-oxohex-4-enyl)-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),15,17(25),18,20(24),21-hexaene-5-carboxylic acid (PubChem CID 91447981) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is (3R,5S,8S)-8-(5-methyl-3-oxohex-4-enyl)-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),15,17(25),18,20(24),21-hexaene-5-carboxylic acid.
| Compound Name | (3R,5S,8S)-8-(5-methyl-3-oxohex-4-enyl)-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),15,17(25),18,20(24),21-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 91447981 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | (3R,5S,8S)-8-(5-methyl-3-oxohex-4-enyl)-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),15,17(25),18,20(24),21-hexaene-5-carboxylic acid |
| SMILES | CC(C)=CC(=O)CC[C@@H]1NC(=O)OCCCC=Cc2ccc3ccnc(c3c2)O[C@@H]2C[C@@H](C(=O)O)N(C2)C1=O |
| InChI | InChI=1S/C29H33N3O7/c1-18(2)14-21(33)9-10-24-27(34)32-17-22(16-25(32)28(35)36)39-26-23-15-19(7-8-20(23)11-12-30-26)6-4-3-5-13-38-29(37)31-24/h4,6-8,11-12,14-15,22,24-25H,3,5,9-10,13,16-17H2,1-2H3,(H,31,37)(H,35,36)/t22-,24+,25+/m1/s1 |
| InChIKey | BTXWMXCLIDSKOE-VJTSUQJLSA-N |
| XLogP | 3.88 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|