C18H23F2NO3 — CID 91448966
benzyl 6-(2,2-difluorobut-3-enoylamino)-2-methylhexanoate (PubChem CID 91448966) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is benzyl 6-(2,2-difluorobut-3-enoylamino)-2-methylhexanoate.
| Compound Name | benzyl 6-(2,2-difluorobut-3-enoylamino)-2-methylhexanoate |
|---|---|
| PubChem CID | 91448966 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | benzyl 6-(2,2-difluorobut-3-enoylamino)-2-methylhexanoate |
| SMILES | C=CC(F)(F)C(=O)NCCCCC(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23F2NO3/c1-3-18(19,20)17(23)21-12-8-7-9-14(2)16(22)24-13-15-10-5-4-6-11-15/h3-6,10-11,14H,1,7-9,12-13H2,2H3,(H,21,23) |
| InChIKey | RVKUFNFZFXXXAH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|