C58H54F4N4O3 — CID 91451650
[4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoyl] 4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoate (PubChem CID 91451650) has the molecular formula C58H54F4N4O3 and a molecular weight of 931.09 g/mol. Its IUPAC name is [4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoyl] 4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoate.
| Compound Name | [4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoyl] 4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoate |
|---|---|
| PubChem CID | 91451650 |
| Molecular Formula | C58H54F4N4O3 |
| Molecular Weight | 931.09 g/mol |
| Exact Mass | 930.41 |
| IUPAC Name | [4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoyl] 4-[3-cyclohexyl-3-(5,6-difluoro-2-phenylbenzimidazol-1-yl)propyl]benzoate |
| SMILES | O=C(OC(=O)c1ccc(CCC(C2CCCCC2)n2c(-c3ccccc3)nc3cc(F)c(F)cc32)cc1)c1ccc(CCC(C2CCCCC2)n2c(-c3ccccc3)nc3cc(F)c(F)cc32)cc1 |
| InChI | InChI=1S/C58H54F4N4O3/c59-45-33-49-53(35-47(45)61)65(55(63-49)41-17-9-3-10-18-41)51(39-13-5-1-6-14-39)31-25-37-21-27-43(28-22-37)57(67)69-58(68)44-29-23-38(24-30-44)26-32-52(40-15-7-2-8-16-40)66-54-36-48(62)46(60)34-50(54)64-56(66)42-19-11-4-12-20-42/h3-4,9-12,17-24,27-30,33-36,39-40,51-52H,1-2,5-8,13-16,25-26,31-32H2 |
| InChIKey | POFIIFMGDRQVHM-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.09 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|