C17H32O5Si — CID 91452436
2-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methyl]butanedioic acid (PubChem CID 91452436) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is 2-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methyl]butanedioic acid.
| Compound Name | 2-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 91452436 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]methyl]butanedioic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC(CC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C17H32O5Si/c1-17(2,3)23(4,5)22-14-8-6-12(7-9-14)10-13(16(20)21)11-15(18)19/h12-14H,6-11H2,1-5H3,(H,18,19)(H,20,21) |
| InChIKey | NXRKQZCEAJFQNE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|