C24H27N3O3S — CID 91454785
1-[1-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl]piperidin-4-yl]pyrrolidine-2-thione (PubChem CID 91454785) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[1-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl]piperidin-4-yl]pyrrolidine-2-thione.
| Compound Name | 1-[1-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl]piperidin-4-yl]pyrrolidine-2-thione |
|---|---|
| PubChem CID | 91454785 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[1-[2-[4-(1,3-benzoxazol-2-yloxy)phenoxy]ethyl]piperidin-4-yl]pyrrolidine-2-thione |
| SMILES | S=C1CCCN1C1CCN(CCOc2ccc(Oc3nc4ccccc4o3)cc2)CC1 |
| InChI | InChI=1S/C24H27N3O3S/c31-23-6-3-13-27(23)18-11-14-26(15-12-18)16-17-28-19-7-9-20(10-8-19)29-24-25-21-4-1-2-5-22(21)30-24/h1-2,4-5,7-10,18H,3,6,11-17H2 |
| InChIKey | IEDXXNNULSKBIH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|