C20H23F3N4OS — CID 91456404
2-[2-methyl-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 91456404) has the molecular formula C20H23F3N4OS and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[2-methyl-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-methyl-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 91456404 |
| Molecular Formula | C20H23F3N4OS |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[2-methyl-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | CC(=CCN1CCN(c2cccc(C(F)(F)F)c2)CC1)CSc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C20H23F3N4OS/c1-15(14-29-19-24-7-5-18(28)25-19)6-8-26-9-11-27(12-10-26)17-4-2-3-16(13-17)20(21,22)23/h2-7,13H,8-12,14H2,1H3,(H,24,25,28) |
| InChIKey | FINIWJRWFYHOKW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|