C18H23F3N6S — CID 54071090
4-methyl-5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 54071090) has the molecular formula C18H23F3N6S and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-methyl-5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-methyl-5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 54071090 |
| Molecular Formula | C18H23F3N6S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-methyl-5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | Cn1c(N)nnc1SCC=CCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H23F3N6S/c1-25-16(22)23-24-17(25)28-12-3-2-7-26-8-10-27(11-9-26)15-6-4-5-14(13-15)18(19,20)21/h2-6,13H,7-12H2,1H3,(H2,22,23) |
| InChIKey | MGMOSQFTNZMFNO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|