C25H26F3N5S — CID 14126759
4-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 14126759) has the molecular formula C25H26F3N5S and a molecular weight of 485.58 g/mol. Its IUPAC name is 4-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline.
| Compound Name | 4-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline |
|---|---|
| PubChem CID | 14126759 |
| Molecular Formula | C25H26F3N5S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 4-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylsulfanyl]-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | Cc1cc2ccccc2n2c(SCCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)nnc12 |
| InChI | InChI=1S/C25H26F3N5S/c1-18-16-19-6-2-3-9-22(19)33-23(18)29-30-24(33)34-15-5-10-31-11-13-32(14-12-31)21-8-4-7-20(17-21)25(26,27)28/h2-4,6-9,16-17H,5,10-15H2,1H3 |
| InChIKey | FIBPPTRMYYVWIG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|