C18H21F3N2S2 — CID 19372867
1-(3-thiophen-2-ylsulfanylpropyl)-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 19372867) has the molecular formula C18H21F3N2S2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-(3-thiophen-2-ylsulfanylpropyl)-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-(3-thiophen-2-ylsulfanylpropyl)-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 19372867 |
| Molecular Formula | C18H21F3N2S2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-(3-thiophen-2-ylsulfanylpropyl)-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(CCCSc3cccs3)CC2)c1 |
| InChI | InChI=1S/C18H21F3N2S2/c19-18(20,21)15-4-1-5-16(14-15)23-10-8-22(9-11-23)7-3-13-25-17-6-2-12-24-17/h1-2,4-6,12,14H,3,7-11,13H2 |
| InChIKey | WJHPWWKLDSESSY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|