C33H41N3O6S — CID 91456438
methyl 19-cyclohexyl-15-[2-[[cyclopropyl(methyl)sulfamoyl]amino]-2-hydroxyethyl]-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate (PubChem CID 91456438) has the molecular formula C33H41N3O6S and a molecular weight of 607.77 g/mol. Its IUPAC name is methyl 19-cyclohexyl-15-[2-[[cyclopropyl(methyl)sulfamoyl]amino]-2-hydroxyethyl]-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate.
| Compound Name | methyl 19-cyclohexyl-15-[2-[[cyclopropyl(methyl)sulfamoyl]amino]-2-hydroxyethyl]-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate |
|---|---|
| PubChem CID | 91456438 |
| Molecular Formula | C33H41N3O6S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | methyl 19-cyclohexyl-15-[2-[[cyclopropyl(methyl)sulfamoyl]amino]-2-hydroxyethyl]-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-10-carboxylate |
| SMILES | COC(=O)C12CC1c1cc(OC)ccc1-c1c(C3CCCCC3)c3ccc(CC(O)NS(=O)(=O)N(C)C4CC4)cc3n1C2 |
| InChI | InChI=1S/C33H41N3O6S/c1-35(22-10-11-22)43(39,40)34-29(37)16-20-9-13-25-28(15-20)36-19-33(32(38)42-3)18-27(33)26-17-23(41-2)12-14-24(26)31(36)30(25)21-7-5-4-6-8-21/h9,12-15,17,21-22,27,29,34,37H,4-8,10-11,16,18-19H2,1-3H3 |
| InChIKey | WYGUBKHQZITMCM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|