C43H88 — CID 91456518
3,7,8,10,12,14-hexaethyl-2,2,4,5,6,9,11,11,13,15,16,17-dodecamethylnonadecane (PubChem CID 91456518) has the molecular formula C43H88 and a molecular weight of 605.18 g/mol. Its IUPAC name is 3,7,8,10,12,14-hexaethyl-2,2,4,5,6,9,11,11,13,15,16,17-dodecamethylnonadecane.
| Compound Name | 3,7,8,10,12,14-hexaethyl-2,2,4,5,6,9,11,11,13,15,16,17-dodecamethylnonadecane |
|---|---|
| PubChem CID | 91456518 |
| Molecular Formula | C43H88 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.69 |
| IUPAC Name | 3,7,8,10,12,14-hexaethyl-2,2,4,5,6,9,11,11,13,15,16,17-dodecamethylnonadecane |
| SMILES | CCC(C)C(C)C(C)C(CC)C(C)C(CC)C(C)(C)C(CC)C(C)C(CC)C(CC)C(C)C(C)C(C)C(CC)C(C)(C)C |
| InChI | InChI=1S/C43H88/c1-21-28(8)29(9)31(11)36(22-2)34(14)40(26-6)43(19,20)41(27-7)35(15)38(24-4)37(23-3)32(12)30(10)33(13)39(25-5)42(16,17)18/h28-41H,21-27H2,1-20H3 |
| InChIKey | XKQFJJZQPOIJML-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |