C7H12N2O2S — CID 91458971
N-ethyl-5-oxothiomorpholine-3-carboxamide (PubChem CID 91458971) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is N-ethyl-5-oxothiomorpholine-3-carboxamide.
| Compound Name | N-ethyl-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 91458971 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | N-ethyl-5-oxothiomorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1CSCC(=O)N1 |
| InChI | InChI=1S/C7H12N2O2S/c1-2-8-7(11)5-3-12-4-6(10)9-5/h5H,2-4H2,1H3,(H,8,11)(H,9,10) |
| InChIKey | DXADRARSTNEKRY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |