C25H29N5O7S — CID 91459718
4-[[5-(benzoylsulfamoyl)-2-ethoxybenzoyl]-hydroxyamino]-1-methyl-3-(2-methylpropyl)pyrazole-5-carboxamide (PubChem CID 91459718) has the molecular formula C25H29N5O7S and a molecular weight of 543.60 g/mol. Its IUPAC name is 4-[[5-(benzoylsulfamoyl)-2-ethoxybenzoyl]-hydroxyamino]-1-methyl-3-(2-methylpropyl)pyrazole-5-carboxamide.
| Compound Name | 4-[[5-(benzoylsulfamoyl)-2-ethoxybenzoyl]-hydroxyamino]-1-methyl-3-(2-methylpropyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 91459718 |
| Molecular Formula | C25H29N5O7S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 4-[[5-(benzoylsulfamoyl)-2-ethoxybenzoyl]-hydroxyamino]-1-methyl-3-(2-methylpropyl)pyrazole-5-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(=O)c2ccccc2)cc1C(=O)N(O)c1c(CC(C)C)nn(C)c1C(N)=O |
| InChI | InChI=1S/C25H29N5O7S/c1-5-37-20-12-11-17(38(35,36)28-24(32)16-9-7-6-8-10-16)14-18(20)25(33)30(34)21-19(13-15(2)3)27-29(4)22(21)23(26)31/h6-12,14-15,34H,5,13H2,1-4H3,(H2,26,31)(H,28,32) |
| InChIKey | QBXJIMKJCJEZJI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|