C34H36ClN5O4 — CID 91460283
(4-methylphenyl) 6-chloro-1-[4-[3-propan-2-yloxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91460283) has the molecular formula C34H36ClN5O4 and a molecular weight of 614.15 g/mol. Its IUPAC name is (4-methylphenyl) 6-chloro-1-[4-[3-propan-2-yloxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methylphenyl) 6-chloro-1-[4-[3-propan-2-yloxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91460283 |
| Molecular Formula | C34H36ClN5O4 |
| Molecular Weight | 614.15 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | (4-methylphenyl) 6-chloro-1-[4-[3-propan-2-yloxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(OCCC(Cn3cncn3)OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H36ClN5O4/c1-22(2)43-28(19-39-21-36-20-37-39)15-17-42-26-11-6-24(7-12-26)33-32-29(30-18-25(35)8-13-31(30)38-32)14-16-40(33)34(41)44-27-9-4-23(3)5-10-27/h4-13,18,20-22,28,33,38H,14-17,19H2,1-3H3 |
| InChIKey | JWTGHIJAXOLJDH-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.15 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|