C21H31N3 — CID 91462052
N-[1-[6-[1-(cyclohexen-1-ylamino)ethyl]-2-pyridinyl]ethyl]cyclohexen-1-amine (PubChem CID 91462052) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-[1-[6-[1-(cyclohexen-1-ylamino)ethyl]-2-pyridinyl]ethyl]cyclohexen-1-amine.
| Compound Name | N-[1-[6-[1-(cyclohexen-1-ylamino)ethyl]-2-pyridinyl]ethyl]cyclohexen-1-amine |
|---|---|
| PubChem CID | 91462052 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N-[1-[6-[1-(cyclohexen-1-ylamino)ethyl]-2-pyridinyl]ethyl]cyclohexen-1-amine |
| SMILES | CC(NC1=CCCCC1)c1cccc(C(C)NC2=CCCCC2)n1 |
| InChI | InChI=1S/C21H31N3/c1-16(22-18-10-5-3-6-11-18)20-14-9-15-21(24-20)17(2)23-19-12-7-4-8-13-19/h9-10,12,14-17,22-23H,3-8,11,13H2,1-2H3 |
| InChIKey | OKYDCKGWZFFCBC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |