C14H18F2N2O4 — CID 91462616
4,4-difluoro-2-(morpholine-4-carbonyl)-5-(1H-pyrrol-2-yl)pentanoic acid (PubChem CID 91462616) has the molecular formula C14H18F2N2O4 and a molecular weight of 316.30 g/mol. Its IUPAC name is 4,4-difluoro-2-(morpholine-4-carbonyl)-5-(1H-pyrrol-2-yl)pentanoic acid.
| Compound Name | 4,4-difluoro-2-(morpholine-4-carbonyl)-5-(1H-pyrrol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 91462616 |
| Molecular Formula | C14H18F2N2O4 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4,4-difluoro-2-(morpholine-4-carbonyl)-5-(1H-pyrrol-2-yl)pentanoic acid |
| SMILES | O=C(O)C(CC(F)(F)Cc1ccc[nH]1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H18F2N2O4/c15-14(16,8-10-2-1-3-17-10)9-11(13(20)21)12(19)18-4-6-22-7-5-18/h1-3,11,17H,4-9H2,(H,20,21) |
| InChIKey | NZSXHMSGOSGXGG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|