C32H26FNO4 — CID 91462930
methyl 2-[4-[3-(4-fluorophenyl)-3-[4-(2-pyridin-2-ylethynyl)phenyl]prop-2-enoxy]-2-methylphenoxy]acetate (PubChem CID 91462930) has the molecular formula C32H26FNO4 and a molecular weight of 507.56 g/mol. Its IUPAC name is methyl 2-[4-[3-(4-fluorophenyl)-3-[4-(2-pyridin-2-ylethynyl)phenyl]prop-2-enoxy]-2-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(4-fluorophenyl)-3-[4-(2-pyridin-2-ylethynyl)phenyl]prop-2-enoxy]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 91462930 |
| Molecular Formula | C32H26FNO4 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | methyl 2-[4-[3-(4-fluorophenyl)-3-[4-(2-pyridin-2-ylethynyl)phenyl]prop-2-enoxy]-2-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(OCC=C(c2ccc(F)cc2)c2ccc(C#Cc3ccccn3)cc2)cc1C |
| InChI | InChI=1S/C32H26FNO4/c1-23-21-29(16-17-31(23)38-22-32(35)36-2)37-20-18-30(26-11-13-27(33)14-12-26)25-9-6-24(7-10-25)8-15-28-5-3-4-19-34-28/h3-7,9-14,16-19,21H,20,22H2,1-2H3 |
| InChIKey | SYYXOENQOIWTGI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|