C13H14N2O3 — CID 91464890
6-hydroxy-5-[1-(3-methylphenyl)ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 91464890) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 6-hydroxy-5-[1-(3-methylphenyl)ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[1-(3-methylphenyl)ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91464890 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 6-hydroxy-5-[1-(3-methylphenyl)ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cccc(C(C)c2c(O)[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C13H14N2O3/c1-7-4-3-5-9(6-7)8(2)10-11(16)14-13(18)15-12(10)17/h3-6,8H,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | GVEBYTHHBNBTIA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |