C12H12BrClN2O — CID 91466069
3-bromo-5-[(4-chlorophenyl)methyl]-2,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole (PubChem CID 91466069) has the molecular formula C12H12BrClN2O and a molecular weight of 315.60 g/mol. Its IUPAC name is 3-bromo-5-[(4-chlorophenyl)methyl]-2,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole.
| Compound Name | 3-bromo-5-[(4-chlorophenyl)methyl]-2,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 91466069 |
| Molecular Formula | C12H12BrClN2O |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 3-bromo-5-[(4-chlorophenyl)methyl]-2,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
| SMILES | Clc1ccc(CN2CC3=C(Br)NOC3C2)cc1 |
| InChI | InChI=1S/C12H12BrClN2O/c13-12-10-6-16(7-11(10)17-15-12)5-8-1-3-9(14)4-2-8/h1-4,11,15H,5-7H2 |
| InChIKey | KEODWJIOXPSXTD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|