C24H21ClN2O2 — CID 91468923
6-(2-chloroethyl)-3-oxo-2-[(2-phenylphenyl)methyl]-1H-isoindole-1-carboxamide (PubChem CID 91468923) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 6-(2-chloroethyl)-3-oxo-2-[(2-phenylphenyl)methyl]-1H-isoindole-1-carboxamide.
| Compound Name | 6-(2-chloroethyl)-3-oxo-2-[(2-phenylphenyl)methyl]-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 91468923 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 6-(2-chloroethyl)-3-oxo-2-[(2-phenylphenyl)methyl]-1H-isoindole-1-carboxamide |
| SMILES | NC(=O)C1c2cc(CCCl)ccc2C(=O)N1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H21ClN2O2/c25-13-12-16-10-11-20-21(14-16)22(23(26)28)27(24(20)29)15-18-8-4-5-9-19(18)17-6-2-1-3-7-17/h1-11,14,22H,12-13,15H2,(H2,26,28) |
| InChIKey | OUURLGQPQXQTDS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|