About ethyl 3-ethylhex-2-enoate
ethyl 3-ethylhex-2-enoate (PubChem CID 91471534) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is ethyl 3-ethylhex-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-ethylhex-2-enoate |
| PubChem CID | 91471534 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | ethyl 3-ethylhex-2-enoate |
| SMILES | CCCC(=CC(=O)OCC)CC |
| InChI | InChI=1S/C10H18O2/c1-4-7-9(5-2)8-10(11)12-6-3/h8H,4-7H2,1-3H3 |
| InChIKey | AMDBYGYJCYMGJR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-ethylhex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-ethylhex-2-enoate?
The IUPAC name of ethyl 3-ethylhex-2-enoate (CID 91471534) is ethyl 3-ethylhex-2-enoate.
What is the SMILES notation for ethyl 3-ethylhex-2-enoate?
The canonical SMILES for ethyl 3-ethylhex-2-enoate is CCCC(=CC(=O)OCC)CC.
What is the InChIKey of ethyl 3-ethylhex-2-enoate?
The InChIKey is AMDBYGYJCYMGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-7-9(5-2)8-10(11)12-6-3/h8H,4-7H2,1-3H3.
What are the key properties of ethyl 3-ethylhex-2-enoate?
ethyl 3-ethylhex-2-enoate has a molecular weight of 170.25 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-ethylhex-2-enoate is sourced from PubChem (CID 91471534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).