C10H14O3 — CID 91472547
3-(1,4-dioxan-2-yl)cyclohex-2-en-1-one (PubChem CID 91472547) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-yl)cyclohex-2-en-1-one.
| Compound Name | 3-(1,4-dioxan-2-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 91472547 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(1,4-dioxan-2-yl)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(C2COCCO2)CCC1 |
| InChI | InChI=1S/C10H14O3/c11-9-3-1-2-8(6-9)10-7-12-4-5-13-10/h6,10H,1-5,7H2 |
| InChIKey | XHONLSHQLUQUPD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |