C20H19N5 — CID 91472752
4-methyl-N-(4-methyl-2-pyrazol-1-ylphenyl)-2-pyrazol-1-ylaniline (PubChem CID 91472752) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 4-methyl-N-(4-methyl-2-pyrazol-1-ylphenyl)-2-pyrazol-1-ylaniline.
| Compound Name | 4-methyl-N-(4-methyl-2-pyrazol-1-ylphenyl)-2-pyrazol-1-ylaniline |
|---|---|
| PubChem CID | 91472752 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-methyl-N-(4-methyl-2-pyrazol-1-ylphenyl)-2-pyrazol-1-ylaniline |
| SMILES | Cc1ccc(Nc2ccc(C)cc2-n2cccn2)c(-n2cccn2)c1 |
| InChI | InChI=1S/C20H19N5/c1-15-5-7-17(19(13-15)24-11-3-9-21-24)23-18-8-6-16(2)14-20(18)25-12-4-10-22-25/h3-14,23H,1-2H3 |
| InChIKey | PPICQPRJBHQQBM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |