C13H15ClN2 — CID 91474364
5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),3,7,13-tetraene (PubChem CID 91474364) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),3,7,13-tetraene.
| Compound Name | 5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),3,7,13-tetraene |
|---|---|
| PubChem CID | 91474364 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-chloro-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),3,7,13-tetraene |
| SMILES | ClC1CC2=CCCC3CC=CC=C3C2N=N1 |
| InChI | InChI=1S/C13H15ClN2/c14-12-8-10-6-3-5-9-4-1-2-7-11(9)13(10)16-15-12/h1-2,6-7,9,12-13H,3-5,8H2 |
| InChIKey | PBQGMZBMAOZQNT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|