About 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene
1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene (PubChem CID 57161509) has the molecular formula C12H14ClN3
and a molecular weight of 235.72 g/mol. Its IUPAC name is 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene |
| PubChem CID | 57161509 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene |
| SMILES | CC(CC1C=CC2=C1C=CC(Cl)C2)N=[N+]=[N-] |
| InChI | InChI=1S/C12H14ClN3/c1-8(15-16-14)6-9-2-3-10-7-11(13)4-5-12(9)10/h2-5,8-9,11H,6-7H2,1H3 |
| InChIKey | WRFSVKGYZDXPDN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene?
The IUPAC name of 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene (CID 57161509) is 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene.
What is the SMILES notation for 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene?
The canonical SMILES for 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene is CC(CC1C=CC2=C1C=CC(Cl)C2)N=[N+]=[N-].
What is the InChIKey of 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene?
The InChIKey is WRFSVKGYZDXPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3/c1-8(15-16-14)6-9-2-3-10-7-11(13)4-5-12(9)10/h2-5,8-9,11H,6-7H2,1H3.
What are the key properties of 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene?
1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene has a molecular weight of 235.72 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-azidopropyl)-5-chloro-4,5-dihydro-1H-indene is sourced from PubChem (CID 57161509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).