C12H13Cl2N3 — CID 56996745
1-(2-azidopropyl)-6,7-dichloro-4,5-dihydro-1H-indene (PubChem CID 56996745) has the molecular formula C12H13Cl2N3 and a molecular weight of 270.16 g/mol. Its IUPAC name is 1-(2-azidopropyl)-6,7-dichloro-4,5-dihydro-1H-indene.
| Compound Name | 1-(2-azidopropyl)-6,7-dichloro-4,5-dihydro-1H-indene |
|---|---|
| PubChem CID | 56996745 |
| Molecular Formula | C12H13Cl2N3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-(2-azidopropyl)-6,7-dichloro-4,5-dihydro-1H-indene |
| SMILES | CC(CC1C=CC2=C1C(Cl)=C(Cl)CC2)N=[N+]=[N-] |
| InChI | InChI=1S/C12H13Cl2N3/c1-7(16-17-15)6-9-3-2-8-4-5-10(13)12(14)11(8)9/h2-3,7,9H,4-6H2,1H3 |
| InChIKey | NWAYLKHCAFVHDU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|