C12H14FN3 — CID 57305500
1-[(2S)-2-azidopropyl]-6-fluoro-4,5-dihydro-1H-indene (PubChem CID 57305500) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 1-[(2S)-2-azidopropyl]-6-fluoro-4,5-dihydro-1H-indene.
| Compound Name | 1-[(2S)-2-azidopropyl]-6-fluoro-4,5-dihydro-1H-indene |
|---|---|
| PubChem CID | 57305500 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 1-[(2S)-2-azidopropyl]-6-fluoro-4,5-dihydro-1H-indene |
| SMILES | C[C@@H](CC1C=CC2=C1C=C(F)CC2)N=[N+]=[N-] |
| InChI | InChI=1S/C12H14FN3/c1-8(15-16-14)6-10-3-2-9-4-5-11(13)7-12(9)10/h2-3,7-8,10H,4-6H2,1H3/t8-,10?/m0/s1 |
| InChIKey | HCJXXQYKUHLSEA-PEHGTWAWSA-N |
| XLogP | 4.21 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|