C14H18FN3 — CID 56989174
1-[(2S)-2-azidopropyl]-7-fluoro-4,4-dimethyl-1,5-dihydroindene (PubChem CID 56989174) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-[(2S)-2-azidopropyl]-7-fluoro-4,4-dimethyl-1,5-dihydroindene.
| Compound Name | 1-[(2S)-2-azidopropyl]-7-fluoro-4,4-dimethyl-1,5-dihydroindene |
|---|---|
| PubChem CID | 56989174 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1-[(2S)-2-azidopropyl]-7-fluoro-4,4-dimethyl-1,5-dihydroindene |
| SMILES | C[C@@H](CC1C=CC2=C1C(F)=CCC2(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C14H18FN3/c1-9(17-18-16)8-10-4-5-11-13(10)12(15)6-7-14(11,2)3/h4-6,9-10H,7-8H2,1-3H3/t9-,10?/m0/s1 |
| InChIKey | XFIRZFYIGPOKMY-RGURZIINSA-N |
| XLogP | 4.84 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|