C14H19N3 — CID 57044198
1-[(2S)-2-azidopropyl]-7-ethyl-4,5-dihydro-1H-indene (PubChem CID 57044198) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-[(2S)-2-azidopropyl]-7-ethyl-4,5-dihydro-1H-indene.
| Compound Name | 1-[(2S)-2-azidopropyl]-7-ethyl-4,5-dihydro-1H-indene |
|---|---|
| PubChem CID | 57044198 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-[(2S)-2-azidopropyl]-7-ethyl-4,5-dihydro-1H-indene |
| SMILES | CCC1=CCCC2=C1C(C[C@H](C)N=[N+]=[N-])C=C2 |
| InChI | InChI=1S/C14H19N3/c1-3-11-5-4-6-12-7-8-13(14(11)12)9-10(2)16-17-15/h5,7-8,10,13H,3-4,6,9H2,1-2H3/t10-,13?/m0/s1 |
| InChIKey | BPLCMVNUIXJPKE-NKUHCKNESA-N |
| XLogP | 4.69 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|