C15H21N3 — CID 57130736
1-[(2S)-2-azidopropyl]-4,4,7-trimethyl-1,5-dihydroindene (PubChem CID 57130736) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-[(2S)-2-azidopropyl]-4,4,7-trimethyl-1,5-dihydroindene.
| Compound Name | 1-[(2S)-2-azidopropyl]-4,4,7-trimethyl-1,5-dihydroindene |
|---|---|
| PubChem CID | 57130736 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-[(2S)-2-azidopropyl]-4,4,7-trimethyl-1,5-dihydroindene |
| SMILES | CC1=CCC(C)(C)C2=C1C(C[C@H](C)N=[N+]=[N-])C=C2 |
| InChI | InChI=1S/C15H21N3/c1-10-7-8-15(3,4)13-6-5-12(14(10)13)9-11(2)17-18-16/h5-7,11-12H,8-9H2,1-4H3/t11-,12?/m0/s1 |
| InChIKey | RLRQBGASRGSYJT-PXYINDEMSA-N |
| XLogP | 4.93 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|