C36H28FN3O3 — CID 91475068
9-benzhydryloxy-5-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinolin-8-ol (PubChem CID 91475068) has the molecular formula C36H28FN3O3 and a molecular weight of 569.64 g/mol. Its IUPAC name is 9-benzhydryloxy-5-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinolin-8-ol.
| Compound Name | 9-benzhydryloxy-5-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinolin-8-ol |
|---|---|
| PubChem CID | 91475068 |
| Molecular Formula | C36H28FN3O3 |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | 9-benzhydryloxy-5-(3,5-dimethyl-1,2-oxazol-4-yl)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinolin-8-ol |
| SMILES | Cc1noc(C)c1-c1c2cccnc2c(OC(c2ccccc2)c2ccccc2)c2c(O)n(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C36H28FN3O3/c1-22-30(23(2)43-39-22)31-28-14-9-19-38-33(28)35(42-34(25-10-5-3-6-11-25)26-12-7-4-8-13-26)32-29(31)21-40(36(32)41)20-24-15-17-27(37)18-16-24/h3-19,21,34,41H,20H2,1-2H3 |
| InChIKey | DWSAZESKOANCBG-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|