C21H24ClN3O3S — CID 91475840
6-chloro-N-(2-methyl-3-phenylprop-2-enyl)-N-[(3R)-2-oxoazepan-3-yl]pyridine-3-sulfonamide (PubChem CID 91475840) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is 6-chloro-N-(2-methyl-3-phenylprop-2-enyl)-N-[(3R)-2-oxoazepan-3-yl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-(2-methyl-3-phenylprop-2-enyl)-N-[(3R)-2-oxoazepan-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 91475840 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 6-chloro-N-(2-methyl-3-phenylprop-2-enyl)-N-[(3R)-2-oxoazepan-3-yl]pyridine-3-sulfonamide |
| SMILES | CC(=Cc1ccccc1)CN([C@@H]1CCCCNC1=O)S(=O)(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C21H24ClN3O3S/c1-16(13-17-7-3-2-4-8-17)15-25(19-9-5-6-12-23-21(19)26)29(27,28)18-10-11-20(22)24-14-18/h2-4,7-8,10-11,13-14,19H,5-6,9,12,15H2,1H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | NQVIEIUHJJCSHF-LJQANCHMSA-N |
| XLogP | 3.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|