C21H36Cl2O2 — CID 91476030
14-(2-bicyclo[2.2.1]heptanyloxy)-7,7-dichlorotetradecanal (PubChem CID 91476030) has the molecular formula C21H36Cl2O2 and a molecular weight of 391.42 g/mol. Its IUPAC name is 14-(2-bicyclo[2.2.1]heptanyloxy)-7,7-dichlorotetradecanal.
| Compound Name | 14-(2-bicyclo[2.2.1]heptanyloxy)-7,7-dichlorotetradecanal |
|---|---|
| PubChem CID | 91476030 |
| Molecular Formula | C21H36Cl2O2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 14-(2-bicyclo[2.2.1]heptanyloxy)-7,7-dichlorotetradecanal |
| SMILES | O=CCCCCCC(Cl)(Cl)CCCCCCCOC1CC2CCC1C2 |
| InChI | InChI=1S/C21H36Cl2O2/c22-21(23,13-7-3-4-8-14-24)12-6-2-1-5-9-15-25-20-17-18-10-11-19(20)16-18/h14,18-20H,1-13,15-17H2 |
| InChIKey | FXUWLBRIQNPERS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|