C23H33N3O3S — CID 91476171
N-[(2-methoxyphenyl)methyl]-2-[(4-methylnonanoylamino)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 91476171) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-[(4-methylnonanoylamino)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-[(4-methylnonanoylamino)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91476171 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-[(4-methylnonanoylamino)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCC(C)CCC(=O)NCc1nc(C(=O)NCc2ccccc2OC)cs1 |
| InChI | InChI=1S/C23H33N3O3S/c1-4-5-6-9-17(2)12-13-21(27)24-15-22-26-19(16-30-22)23(28)25-14-18-10-7-8-11-20(18)29-3/h7-8,10-11,16-17H,4-6,9,12-15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | PIDNNVZCXKPPPE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|